C16H24N4S — CID 60871032
4-(4-thieno[3,2-c]pyridin-4-yl-1,4-diazepan-1-yl)butan-1-amine (PubChem CID 60871032) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-(4-thieno[3,2-c]pyridin-4-yl-1,4-diazepan-1-yl)butan-1-amine.
| Compound Name | 4-(4-thieno[3,2-c]pyridin-4-yl-1,4-diazepan-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 60871032 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-(4-thieno[3,2-c]pyridin-4-yl-1,4-diazepan-1-yl)butan-1-amine |
| SMILES | NCCCCN1CCCN(c2nccc3sccc23)CC1 |
| InChI | InChI=1S/C16H24N4S/c17-6-1-2-8-19-9-3-10-20(12-11-19)16-14-5-13-21-15(14)4-7-18-16/h4-5,7,13H,1-3,6,8-12,17H2 |
| InChIKey | OVHVKMOEUQZWHA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|