C15H25BrN4 — CID 106875247
3-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]pentan-1-amine (PubChem CID 106875247) has the molecular formula C15H25BrN4 and a molecular weight of 341.30 g/mol. Its IUPAC name is 3-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]pentan-1-amine.
| Compound Name | 3-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 106875247 |
| Molecular Formula | C15H25BrN4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]pentan-1-amine |
| SMILES | CCC(CCN)N1CCN(c2nccc(C)c2Br)CC1 |
| InChI | InChI=1S/C15H25BrN4/c1-3-13(4-6-17)19-8-10-20(11-9-19)15-14(16)12(2)5-7-18-15/h5,7,13H,3-4,6,8-11,17H2,1-2H3 |
| InChIKey | XXGWMNRZTFUYNI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |