C12H16ClN5 — CID 113446610
4-[4-(2-chloroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine (PubChem CID 113446610) has the molecular formula C12H16ClN5 and a molecular weight of 265.75 g/mol. Its IUPAC name is 4-[4-(2-chloroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine.
| Compound Name | 4-[4-(2-chloroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 113446610 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-[4-(2-chloroethyl)piperazin-1-yl]pyrazolo[1,5-a]pyrazine |
| SMILES | ClCCN1CCN(c2nccn3nccc23)CC1 |
| InChI | InChI=1S/C12H16ClN5/c13-2-5-16-7-9-17(10-8-16)12-11-1-3-15-18(11)6-4-14-12/h1,3-4,6H,2,5,7-10H2 |
| InChIKey | QMXIIRMRFZWXKG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|