C19H33N3O — CID 153436946
1-(5-tert-butyl-2-pyridinyl)-4-[2-(2-methylpropoxy)ethyl]piperazine (PubChem CID 153436946) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-pyridinyl)-4-[2-(2-methylpropoxy)ethyl]piperazine.
| Compound Name | 1-(5-tert-butyl-2-pyridinyl)-4-[2-(2-methylpropoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 153436946 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 1-(5-tert-butyl-2-pyridinyl)-4-[2-(2-methylpropoxy)ethyl]piperazine |
| SMILES | CC(C)COCCN1CCN(c2ccc(C(C)(C)C)cn2)CC1 |
| InChI | InChI=1S/C19H33N3O/c1-16(2)15-23-13-12-21-8-10-22(11-9-21)18-7-6-17(14-20-18)19(3,4)5/h6-7,14,16H,8-13,15H2,1-5H3 |
| InChIKey | DLLAZPZFLQQJOB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|