C9H11N2O3S2- — CID 7063956
5-morpholin-4-ylsulfonylpyridine-2-thiolate (PubChem CID 7063956) has the molecular formula C9H11N2O3S2- and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonylpyridine-2-thiolate.
| Compound Name | 5-morpholin-4-ylsulfonylpyridine-2-thiolate |
|---|---|
| PubChem CID | 7063956 |
| Molecular Formula | C9H11N2O3S2- |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-morpholin-4-ylsulfonylpyridine-2-thiolate |
| SMILES | O=S(=O)(c1ccc([S-])nc1)N1CCOCC1 |
| InChI | InChI=1S/C9H12N2O3S2/c12-16(13,11-3-5-14-6-4-11)8-1-2-9(15)10-7-8/h1-2,7H,3-6H2,(H,10,15)/p-1 |
| InChIKey | VCNXVLIMLQVVFT-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|