C16H16ClF4N3O2 — CID 167425726
2-chloro-4-[4-(difluoromethoxy)cyclohexyl]oxy-5-[1-(difluoromethyl)pyrazol-4-yl]pyridine (PubChem CID 167425726) has the molecular formula C16H16ClF4N3O2 and a molecular weight of 393.77 g/mol. Its IUPAC name is 2-chloro-4-[4-(difluoromethoxy)cyclohexyl]oxy-5-[1-(difluoromethyl)pyrazol-4-yl]pyridine.
| Compound Name | 2-chloro-4-[4-(difluoromethoxy)cyclohexyl]oxy-5-[1-(difluoromethyl)pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 167425726 |
| Molecular Formula | C16H16ClF4N3O2 |
| Molecular Weight | 393.77 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-chloro-4-[4-(difluoromethoxy)cyclohexyl]oxy-5-[1-(difluoromethyl)pyrazol-4-yl]pyridine |
| SMILES | FC(F)OC1CCC(Oc2cc(Cl)ncc2-c2cnn(C(F)F)c2)CC1 |
| InChI | InChI=1S/C16H16ClF4N3O2/c17-14-5-13(25-10-1-3-11(4-2-10)26-16(20)21)12(7-22-14)9-6-23-24(8-9)15(18)19/h5-8,10-11,15-16H,1-4H2 |
| InChIKey | VZASGJWVBLRSGH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|