C9H11ClN2OS — CID 130637835
3-[(2-chlorothiophen-3-yl)amino]piperidin-2-one (PubChem CID 130637835) has the molecular formula C9H11ClN2OS and a molecular weight of 230.72 g/mol. Its IUPAC name is 3-[(2-chlorothiophen-3-yl)amino]piperidin-2-one.
| Compound Name | 3-[(2-chlorothiophen-3-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 130637835 |
| Molecular Formula | C9H11ClN2OS |
| Molecular Weight | 230.72 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-[(2-chlorothiophen-3-yl)amino]piperidin-2-one |
| SMILES | O=C1NCCCC1Nc1ccsc1Cl |
| InChI | InChI=1S/C9H11ClN2OS/c10-8-6(3-5-14-8)12-7-2-1-4-11-9(7)13/h3,5,7,12H,1-2,4H2,(H,11,13) |
| InChIKey | BGAVAWCRBHOLCM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |