C20H21N5O — CID 135249413
1-[1-[3-[2-(1-methylpyrazol-4-yl)ethynyl]imidazo[1,2-a]pyridin-5-yl]piperidin-4-yl]ethanone (PubChem CID 135249413) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[1-[3-[2-(1-methylpyrazol-4-yl)ethynyl]imidazo[1,2-a]pyridin-5-yl]piperidin-4-yl]ethanone.
| Compound Name | 1-[1-[3-[2-(1-methylpyrazol-4-yl)ethynyl]imidazo[1,2-a]pyridin-5-yl]piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 135249413 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-[1-[3-[2-(1-methylpyrazol-4-yl)ethynyl]imidazo[1,2-a]pyridin-5-yl]piperidin-4-yl]ethanone |
| SMILES | CC(=O)C1CCN(c2cccc3ncc(C#Cc4cnn(C)c4)n23)CC1 |
| InChI | InChI=1S/C20H21N5O/c1-15(26)17-8-10-24(11-9-17)20-5-3-4-19-21-13-18(25(19)20)7-6-16-12-22-23(2)14-16/h3-5,12-14,17H,8-11H2,1-2H3 |
| InChIKey | MJRZVHSUMIAICQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|