C15H10N2O2 — CID 59416972
4-[4-(1-methylpyrazol-4-yl)buta-1,3-diynyl]benzoic acid (PubChem CID 59416972) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-[4-(1-methylpyrazol-4-yl)buta-1,3-diynyl]benzoic acid.
| Compound Name | 4-[4-(1-methylpyrazol-4-yl)buta-1,3-diynyl]benzoic acid |
|---|---|
| PubChem CID | 59416972 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-[4-(1-methylpyrazol-4-yl)buta-1,3-diynyl]benzoic acid |
| SMILES | Cn1cc(C#CC#Cc2ccc(C(=O)O)cc2)cn1 |
| InChI | InChI=1S/C15H10N2O2/c1-17-11-13(10-16-17)5-3-2-4-12-6-8-14(9-7-12)15(18)19/h6-11H,1H3,(H,18,19) |
| InChIKey | OIOTUDIVGPPZDR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|