C16H18ClN3O3 — CID 164580008
4-[1-(7-chloro-1,6-naphthyridin-2-yl)-1-hydroxyethyl]piperidine-1-carboxylic acid (PubChem CID 164580008) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 4-[1-(7-chloro-1,6-naphthyridin-2-yl)-1-hydroxyethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[1-(7-chloro-1,6-naphthyridin-2-yl)-1-hydroxyethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 164580008 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-[1-(7-chloro-1,6-naphthyridin-2-yl)-1-hydroxyethyl]piperidine-1-carboxylic acid |
| SMILES | CC(O)(c1ccc2cnc(Cl)cc2n1)C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-16(23,11-4-6-20(7-5-11)15(21)22)13-3-2-10-9-18-14(17)8-12(10)19-13/h2-3,8-9,11,23H,4-7H2,1H3,(H,21,22) |
| InChIKey | KNUQBXYCSIHNTI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|