C17H20ClN3O2 — CID 156719479
ethyl 2-(7-chloro-1,6-naphthyridin-2-yl)-2-piperidin-4-ylacetate (PubChem CID 156719479) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is ethyl 2-(7-chloro-1,6-naphthyridin-2-yl)-2-piperidin-4-ylacetate.
| Compound Name | ethyl 2-(7-chloro-1,6-naphthyridin-2-yl)-2-piperidin-4-ylacetate |
|---|---|
| PubChem CID | 156719479 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | ethyl 2-(7-chloro-1,6-naphthyridin-2-yl)-2-piperidin-4-ylacetate |
| SMILES | CCOC(=O)C(c1ccc2cnc(Cl)cc2n1)C1CCNCC1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-2-23-17(22)16(11-5-7-19-8-6-11)13-4-3-12-10-20-15(18)9-14(12)21-13/h3-4,9-11,16,19H,2,5-8H2,1H3 |
| InChIKey | HXDFVZXAAXIJAX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|