C18H14Cl2N4O2 — CID 175776436
(7-chloro-1,6-naphthyridin-2-yl) (2E)-2-[(4-amino-6-chloro-3-pyridinyl)methylidene]butanoate (PubChem CID 175776436) has the molecular formula C18H14Cl2N4O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is (7-chloro-1,6-naphthyridin-2-yl) (2E)-2-[(4-amino-6-chloro-3-pyridinyl)methylidene]butanoate.
| Compound Name | (7-chloro-1,6-naphthyridin-2-yl) (2E)-2-[(4-amino-6-chloro-3-pyridinyl)methylidene]butanoate |
|---|---|
| PubChem CID | 175776436 |
| Molecular Formula | C18H14Cl2N4O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (7-chloro-1,6-naphthyridin-2-yl) (2E)-2-[(4-amino-6-chloro-3-pyridinyl)methylidene]butanoate |
| SMILES | CC/C(=C\c1cnc(Cl)cc1N)C(=O)Oc1ccc2cnc(Cl)cc2n1 |
| InChI | InChI=1S/C18H14Cl2N4O2/c1-2-10(5-12-9-23-15(19)6-13(12)21)18(25)26-17-4-3-11-8-22-16(20)7-14(11)24-17/h3-9H,2H2,1H3,(H2,21,23)/b10-5+ |
| InChIKey | ATXVXGMANFYJLQ-BJMVGYQFSA-N |
| XLogP | 4.31 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|