C21H23Cl2NO5 — CID 91108866
ethyl 2-[[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]methylidene]butanoate (PubChem CID 91108866) has the molecular formula C21H23Cl2NO5 and a molecular weight of 440.32 g/mol. Its IUPAC name is ethyl 2-[[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]methylidene]butanoate.
| Compound Name | ethyl 2-[[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 91108866 |
| Molecular Formula | C21H23Cl2NO5 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | ethyl 2-[[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]methylidene]butanoate |
| SMILES | CCOC(=O)C(=Cc1ccc(OCCOC)cc1Oc1ncc(Cl)cc1Cl)CC |
| InChI | InChI=1S/C21H23Cl2NO5/c1-4-14(21(25)27-5-2)10-15-6-7-17(28-9-8-26-3)12-19(15)29-20-18(23)11-16(22)13-24-20/h6-7,10-13H,4-5,8-9H2,1-3H3 |
| InChIKey | NIVWPFXDKZLXFA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|