C21H18ClF3N2O4 — CID 91485911
ethyl 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoate (PubChem CID 91485911) has the molecular formula C21H18ClF3N2O4 and a molecular weight of 454.83 g/mol. Its IUPAC name is ethyl 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91485911 |
| Molecular Formula | C21H18ClF3N2O4 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | ethyl 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(OCCCC#N)cc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C21H18ClF3N2O4/c1-2-29-19(28)8-6-14-5-7-16(30-10-4-3-9-26)12-18(14)31-20-17(22)11-15(13-27-20)21(23,24)25/h5-8,11-13H,2-4,10H2,1H3 |
| InChIKey | FNHILDSUQHLJIE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|