C19H14ClF3N2O4 — CID 68551388
(E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoic acid (PubChem CID 68551388) has the molecular formula C19H14ClF3N2O4 and a molecular weight of 426.78 g/mol. Its IUPAC name is (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68551388 |
| Molecular Formula | C19H14ClF3N2O4 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-cyanopropoxy)phenyl]prop-2-enoic acid |
| SMILES | N#CCCCOc1ccc(/C=C/C(=O)O)c(Oc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C19H14ClF3N2O4/c20-15-9-13(19(21,22)23)11-25-18(15)29-16-10-14(28-8-2-1-7-24)5-3-12(16)4-6-17(26)27/h3-6,9-11H,1-2,8H2,(H,26,27)/b6-4+ |
| InChIKey | AKVNSABYUOJJFF-GQCTYLIASA-N |
| XLogP | 5.33 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|