C17H13ClF3NO5 — CID 68545576
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid (PubChem CID 68545576) has the molecular formula C17H13ClF3NO5 and a molecular weight of 403.74 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68545576 |
| Molecular Formula | C17H13ClF3NO5 |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OCCO)cc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H13ClF3NO5/c18-13-7-11(17(19,20)21)9-22-16(13)27-14-8-12(26-6-5-23)3-1-10(14)2-4-15(24)25/h1-4,7-9,23H,5-6H2,(H,24,25) |
| InChIKey | LIJRKDYOVIWBLH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|