C28H37ClF3NO5Si — CID 86617674
ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]prop-2-enoate (PubChem CID 86617674) has the molecular formula C28H37ClF3NO5Si and a molecular weight of 588.14 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86617674 |
| Molecular Formula | C28H37ClF3NO5Si |
| Molecular Weight | 588.14 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCCO[Si](C(C)C)(C(C)C)C(C)C)cc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C28H37ClF3NO5Si/c1-8-35-26(34)12-10-21-9-11-23(36-13-14-37-39(18(2)3,19(4)5)20(6)7)16-25(21)38-27-24(29)15-22(17-33-27)28(30,31)32/h9-12,15-20H,8,13-14H2,1-7H3/b12-10+ |
| InChIKey | KAXJKFALBXFZDI-ZRDIBKRKSA-N |
| XLogP | 8.69 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.14 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|