C26H37ClF3NO4Si — CID 68550039
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]propan-1-ol (PubChem CID 68550039) has the molecular formula C26H37ClF3NO4Si and a molecular weight of 548.12 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]propan-1-ol.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 68550039 |
| Molecular Formula | C26H37ClF3NO4Si |
| Molecular Weight | 548.12 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-tri(propan-2-yl)silyloxyethoxy]phenyl]propan-1-ol |
| SMILES | CC(C)[Si](OCCOc1ccc(CCCO)c(Oc2ncc(C(F)(F)F)cc2Cl)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H37ClF3NO4Si/c1-17(2)36(18(3)4,19(5)6)34-13-12-33-22-10-9-20(8-7-11-32)24(15-22)35-25-23(27)14-21(16-31-25)26(28,29)30/h9-10,14-19,32H,7-8,11-13H2,1-6H3 |
| InChIKey | TXGBMBSCPLBFBG-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.12 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|