C16H15ClF3NO4 — CID 68552856
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methanol (PubChem CID 68552856) has the molecular formula C16H15ClF3NO4 and a molecular weight of 377.75 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methanol.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 68552856 |
| Molecular Formula | C16H15ClF3NO4 |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methanol |
| SMILES | COCCOc1ccc(CO)c(Oc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C16H15ClF3NO4/c1-23-4-5-24-12-3-2-10(9-22)14(7-12)25-15-13(17)6-11(8-21-15)16(18,19)20/h2-3,6-8,22H,4-5,9H2,1H3 |
| InChIKey | ZCSHTUNZGBHTIM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|