C24H29ClF3N3O7S — CID 140521763
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl N-(cyclohexylmethylsulfamoyl)carbamate (PubChem CID 140521763) has the molecular formula C24H29ClF3N3O7S and a molecular weight of 596.02 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl N-(cyclohexylmethylsulfamoyl)carbamate.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl N-(cyclohexylmethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 140521763 |
| Molecular Formula | C24H29ClF3N3O7S |
| Molecular Weight | 596.02 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl N-(cyclohexylmethylsulfamoyl)carbamate |
| SMILES | COCCOc1ccc(COC(=O)NS(=O)(=O)NCC2CCCCC2)c(Oc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C24H29ClF3N3O7S/c1-35-9-10-36-19-8-7-17(21(12-19)38-22-20(25)11-18(14-29-22)24(26,27)28)15-37-23(32)31-39(33,34)30-13-16-5-3-2-4-6-16/h7-8,11-12,14,16,30H,2-6,9-10,13,15H2,1H3,(H,31,32) |
| InChIKey | DOXTXNCMROKJHS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.02 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|