C25H24ClF3N2O6S — CID 68552961
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]-N-(4-methylphenyl)sulfonylpropanamide (PubChem CID 68552961) has the molecular formula C25H24ClF3N2O6S and a molecular weight of 572.99 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]-N-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]-N-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 68552961 |
| Molecular Formula | C25H24ClF3N2O6S |
| Molecular Weight | 572.99 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]-N-(4-methylphenyl)sulfonylpropanamide |
| SMILES | COCCOc1ccc(CCC(=O)NS(=O)(=O)c2ccc(C)cc2)c(Oc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C25H24ClF3N2O6S/c1-16-3-8-20(9-4-16)38(33,34)31-23(32)10-6-17-5-7-19(36-12-11-35-2)14-22(17)37-24-21(26)13-18(15-30-24)25(27,28)29/h3-5,7-9,13-15H,6,10-12H2,1-2H3,(H,31,32) |
| InChIKey | RJHLFDBOHIAYAH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.99 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|