C22H27ClF3N3O7S — CID 87697851
[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl-pentylsulfamoyl] carbamate (PubChem CID 87697851) has the molecular formula C22H27ClF3N3O7S and a molecular weight of 569.99 g/mol. Its IUPAC name is [[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl-pentylsulfamoyl] carbamate.
| Compound Name | [[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl-pentylsulfamoyl] carbamate |
|---|---|
| PubChem CID | 87697851 |
| Molecular Formula | C22H27ClF3N3O7S |
| Molecular Weight | 569.99 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | [[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(2-methoxyethoxy)phenyl]methyl-pentylsulfamoyl] carbamate |
| SMILES | CCCCCN(Cc1ccc(OCCOC)cc1Oc1ncc(C(F)(F)F)cc1Cl)S(=O)(=O)OC(N)=O |
| InChI | InChI=1S/C22H27ClF3N3O7S/c1-3-4-5-8-29(37(31,32)36-21(27)30)14-15-6-7-17(34-10-9-33-2)12-19(15)35-20-18(23)11-16(13-28-20)22(24,25)26/h6-7,11-13H,3-5,8-10,14H2,1-2H3,(H2,27,30) |
| InChIKey | YGWMAGZNCZLRMD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|