C25H30ClF3N2O7S — CID 68549589
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-N-pentylsulfonylprop-2-enamide (PubChem CID 68549589) has the molecular formula C25H30ClF3N2O7S and a molecular weight of 595.04 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 68549589 |
| Molecular Formula | C25H30ClF3N2O7S |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)C=Cc1ccc(OCCOCCOC)cc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C25H30ClF3N2O7S/c1-3-4-5-14-39(33,34)31-23(32)9-7-18-6-8-20(37-13-12-36-11-10-35-2)16-22(18)38-24-21(26)15-19(17-30-24)25(27,28)29/h6-9,15-17H,3-5,10-14H2,1-2H3,(H,31,32) |
| InChIKey | SWRNLHFKLWZEOF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|