C24H28Cl2N2O6S — CID 68553513
2,4-dichloro-N-[5-(2-methoxyethoxy)-2-[(E)-3-oxo-3-(pentylsulfonylamino)prop-1-enyl]phenyl]benzamide (PubChem CID 68553513) has the molecular formula C24H28Cl2N2O6S and a molecular weight of 543.47 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-(2-methoxyethoxy)-2-[(E)-3-oxo-3-(pentylsulfonylamino)prop-1-enyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-(2-methoxyethoxy)-2-[(E)-3-oxo-3-(pentylsulfonylamino)prop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 68553513 |
| Molecular Formula | C24H28Cl2N2O6S |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 2,4-dichloro-N-[5-(2-methoxyethoxy)-2-[(E)-3-oxo-3-(pentylsulfonylamino)prop-1-enyl]phenyl]benzamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)/C=C/c1ccc(OCCOC)cc1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H28Cl2N2O6S/c1-3-4-5-14-35(31,32)28-23(29)11-7-17-6-9-19(34-13-12-33-2)16-22(17)27-24(30)20-10-8-18(25)15-21(20)26/h6-11,15-16H,3-5,12-14H2,1-2H3,(H,27,30)(H,28,29)/b11-7+ |
| InChIKey | UZDMSUIOEYKAMH-YRNVUSSQSA-N |
| XLogP | 4.92 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|