C19H23Cl2N3O3S — CID 21198572
(E)-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]-N-pentylsulfonylprop-2-enamide (PubChem CID 21198572) has the molecular formula C19H23Cl2N3O3S and a molecular weight of 444.38 g/mol. Its IUPAC name is (E)-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 21198572 |
| Molecular Formula | C19H23Cl2N3O3S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)/C=C/c1cn(Cc2ccc(Cl)cc2Cl)c(C)n1 |
| InChI | InChI=1S/C19H23Cl2N3O3S/c1-3-4-5-10-28(26,27)23-19(25)9-8-17-13-24(14(2)22-17)12-15-6-7-16(20)11-18(15)21/h6-9,11,13H,3-5,10,12H2,1-2H3,(H,23,25)/b9-8+ |
| InChIKey | HZDAKMSVROWJPV-CMDGGOBGSA-N |
| XLogP | 4.20 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|