C23H29ClF3N3O3S — CID 69077340
3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]-N-pentylsulfonylprop-2-enamide (PubChem CID 69077340) has the molecular formula C23H29ClF3N3O3S and a molecular weight of 520.02 g/mol. Its IUPAC name is 3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | 3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 69077340 |
| Molecular Formula | C23H29ClF3N3O3S |
| Molecular Weight | 520.02 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)C=Cc1cc(C(C)(C)C)nn1Cc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C23H29ClF3N3O3S/c1-5-6-7-12-34(32,33)29-21(31)11-10-18-14-20(22(2,3)4)28-30(18)15-16-8-9-17(13-19(16)24)23(25,26)27/h8-11,13-14H,5-7,12,15H2,1-4H3,(H,29,31) |
| InChIKey | CUNFVYBTSOKGNO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.02 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|