C18H18ClF3N2O2 — CID 68551880
(E)-3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]prop-2-enoic acid (PubChem CID 68551880) has the molecular formula C18H18ClF3N2O2 and a molecular weight of 386.80 g/mol. Its IUPAC name is (E)-3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68551880 |
| Molecular Formula | C18H18ClF3N2O2 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (E)-3-[3-tert-butyl-1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]pyrazol-5-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)O)n(Cc2ccc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C18H18ClF3N2O2/c1-17(2,3)15-9-13(6-7-16(25)26)24(23-15)10-11-4-5-12(8-14(11)19)18(20,21)22/h4-9H,10H2,1-3H3,(H,25,26)/b7-6+ |
| InChIKey | DZJHGGPILLGZIA-VOTSOKGWSA-N |
| XLogP | 5.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|