C21H25ClF3N3O5S — CID 68550285
(E)-3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-propan-2-yloxypyrazol-5-yl]-N-(3-methoxypropylsulfonyl)prop-2-enamide (PubChem CID 68550285) has the molecular formula C21H25ClF3N3O5S and a molecular weight of 523.96 g/mol. Its IUPAC name is (E)-3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-propan-2-yloxypyrazol-5-yl]-N-(3-methoxypropylsulfonyl)prop-2-enamide.
| Compound Name | (E)-3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-propan-2-yloxypyrazol-5-yl]-N-(3-methoxypropylsulfonyl)prop-2-enamide |
|---|---|
| PubChem CID | 68550285 |
| Molecular Formula | C21H25ClF3N3O5S |
| Molecular Weight | 523.96 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | (E)-3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-propan-2-yloxypyrazol-5-yl]-N-(3-methoxypropylsulfonyl)prop-2-enamide |
| SMILES | COCCCS(=O)(=O)NC(=O)/C=C/c1cc(OC(C)C)nn1Cc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C21H25ClF3N3O5S/c1-14(2)33-20-12-17(7-8-19(29)27-34(30,31)10-4-9-32-3)28(26-20)13-15-5-6-16(11-18(15)22)21(23,24)25/h5-8,11-12,14H,4,9-10,13H2,1-3H3,(H,27,29)/b8-7+ |
| InChIKey | LQGGFQRKKXBEIV-BQYQJAHWSA-N |
| XLogP | 3.89 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|