C19H23Cl2N3O6S — CID 86617776
tert-butyl N-[(E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenyl]sulfonylcarbamate (PubChem CID 86617776) has the molecular formula C19H23Cl2N3O6S and a molecular weight of 492.38 g/mol. Its IUPAC name is tert-butyl N-[(E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenyl]sulfonylcarbamate.
| Compound Name | tert-butyl N-[(E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 86617776 |
| Molecular Formula | C19H23Cl2N3O6S |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | tert-butyl N-[(E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenyl]sulfonylcarbamate |
| SMILES | COCOc1cc(/C=C/S(=O)(=O)NC(=O)OC(C)(C)C)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C19H23Cl2N3O6S/c1-19(2,3)30-18(25)23-31(26,27)8-7-15-10-17(29-12-28-4)22-24(15)11-13-5-6-14(20)9-16(13)21/h5-10H,11-12H2,1-4H3,(H,23,25)/b8-7+ |
| InChIKey | CCESVOKEHNOSSW-BQYQJAHWSA-N |
| XLogP | 4.05 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|