C19H22Cl2N2O3 — CID 68551908
ethyl (E)-3-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]prop-2-enoate (PubChem CID 68551908) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is ethyl (E)-3-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 68551908 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | ethyl (E)-3-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]prop-2-enoate |
| SMILES | CCCCOc1cc(/C=C/C(=O)OCC)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C19H22Cl2N2O3/c1-3-5-10-26-18-12-16(8-9-19(24)25-4-2)23(22-18)13-14-6-7-15(20)11-17(14)21/h6-9,11-12H,3-5,10,13H2,1-2H3/b9-8+ |
| InChIKey | LCXBTWCKPHTBLJ-CMDGGOBGSA-N |
| XLogP | 4.99 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|