C14H15Cl2N3O4S — CID 141168612
(E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonamide (PubChem CID 141168612) has the molecular formula C14H15Cl2N3O4S and a molecular weight of 392.26 g/mol. Its IUPAC name is (E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonamide.
| Compound Name | (E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 141168612 |
| Molecular Formula | C14H15Cl2N3O4S |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | (E)-2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonamide |
| SMILES | COCOc1cc(/C=C/S(N)(=O)=O)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H15Cl2N3O4S/c1-22-9-23-14-7-12(4-5-24(17,20)21)19(18-14)8-10-2-3-11(15)6-13(10)16/h2-7H,8-9H2,1H3,(H2,17,20,21)/b5-4+ |
| InChIKey | OTSKRTAAFOXCSD-SNAWJCMRSA-N |
| XLogP | 2.48 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|