C17H19Cl2N3O5S — CID 87700455
carbamoyl (E)-2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethenesulfonate (PubChem CID 87700455) has the molecular formula C17H19Cl2N3O5S and a molecular weight of 448.33 g/mol. Its IUPAC name is carbamoyl (E)-2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethenesulfonate.
| Compound Name | carbamoyl (E)-2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethenesulfonate |
|---|---|
| PubChem CID | 87700455 |
| Molecular Formula | C17H19Cl2N3O5S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | carbamoyl (E)-2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethenesulfonate |
| SMILES | CCCCOc1cc(/C=C/S(=O)(=O)OC(N)=O)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H19Cl2N3O5S/c1-2-3-7-26-16-10-14(6-8-28(24,25)27-17(20)23)22(21-16)11-12-4-5-13(18)9-15(12)19/h4-6,8-10H,2-3,7,11H2,1H3,(H2,20,23)/b8-6+ |
| InChIKey | XXXNSLUQQXRYEO-SOFGYWHQSA-N |
| XLogP | 3.81 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|