C22H31Cl2N3O5S — CID 91570316
pentylcarbamoyl 2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethanesulfonate (PubChem CID 91570316) has the molecular formula C22H31Cl2N3O5S and a molecular weight of 520.48 g/mol. Its IUPAC name is pentylcarbamoyl 2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethanesulfonate.
| Compound Name | pentylcarbamoyl 2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethanesulfonate |
|---|---|
| PubChem CID | 91570316 |
| Molecular Formula | C22H31Cl2N3O5S |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | pentylcarbamoyl 2-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]ethanesulfonate |
| SMILES | CCCCCNC(=O)OS(=O)(=O)CCc1cc(OCCCC)nn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H31Cl2N3O5S/c1-3-5-7-11-25-22(28)32-33(29,30)13-10-19-15-21(31-12-6-4-2)26-27(19)16-17-8-9-18(23)14-20(17)24/h8-9,14-15H,3-7,10-13,16H2,1-2H3,(H,25,28) |
| InChIKey | HDZFEGQYANOZSK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|