C21H29Cl2N3O5S — CID 87700812
carbamoyl 1-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]-4-methylpentane-2-sulfonate (PubChem CID 87700812) has the molecular formula C21H29Cl2N3O5S and a molecular weight of 506.45 g/mol. Its IUPAC name is carbamoyl 1-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]-4-methylpentane-2-sulfonate.
| Compound Name | carbamoyl 1-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]-4-methylpentane-2-sulfonate |
|---|---|
| PubChem CID | 87700812 |
| Molecular Formula | C21H29Cl2N3O5S |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | carbamoyl 1-[3-butoxy-1-[(2,4-dichlorophenyl)methyl]pyrazol-5-yl]-4-methylpentane-2-sulfonate |
| SMILES | CCCCOc1cc(CC(CC(C)C)S(=O)(=O)OC(N)=O)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C21H29Cl2N3O5S/c1-4-5-8-30-20-12-17(11-18(9-14(2)3)32(28,29)31-21(24)27)26(25-20)13-15-6-7-16(22)10-19(15)23/h6-7,10,12,14,18H,4-5,8-9,11,13H2,1-3H3,(H2,24,27) |
| InChIKey | DXZBAQAMFTYADV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|