C15H15Cl2N3O6S — CID 173139766
carbamoyl 2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonate (PubChem CID 173139766) has the molecular formula C15H15Cl2N3O6S and a molecular weight of 436.27 g/mol. Its IUPAC name is carbamoyl 2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonate.
| Compound Name | carbamoyl 2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonate |
|---|---|
| PubChem CID | 173139766 |
| Molecular Formula | C15H15Cl2N3O6S |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | carbamoyl 2-[1-[(2,4-dichlorophenyl)methyl]-3-(methoxymethoxy)pyrazol-5-yl]ethenesulfonate |
| SMILES | COCOc1cc(C=CS(=O)(=O)OC(N)=O)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H15Cl2N3O6S/c1-24-9-25-14-7-12(4-5-27(22,23)26-15(18)21)20(19-14)8-10-2-3-11(16)6-13(10)17/h2-7H,8-9H2,1H3,(H2,18,21) |
| InChIKey | FMWYASJUCPQTEE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|