C18H18ClF3N2O4 — CID 174548635
(E)-5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(methoxymethoxy)pyrazol-5-yl]pent-2-enoic acid (PubChem CID 174548635) has the molecular formula C18H18ClF3N2O4 and a molecular weight of 418.80 g/mol. Its IUPAC name is (E)-5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(methoxymethoxy)pyrazol-5-yl]pent-2-enoic acid.
| Compound Name | (E)-5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(methoxymethoxy)pyrazol-5-yl]pent-2-enoic acid |
|---|---|
| PubChem CID | 174548635 |
| Molecular Formula | C18H18ClF3N2O4 |
| Molecular Weight | 418.80 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (E)-5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(methoxymethoxy)pyrazol-5-yl]pent-2-enoic acid |
| SMILES | COCOc1cc(CC/C=C/C(=O)O)n(Cc2ccc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C18H18ClF3N2O4/c1-27-11-28-16-9-14(4-2-3-5-17(25)26)24(23-16)10-12-6-7-13(8-15(12)19)18(20,21)22/h3,5-9H,2,4,10-11H2,1H3,(H,25,26)/b5-3+ |
| InChIKey | NUMDNIUVLVSYSR-HWKANZROSA-N |
| XLogP | 4.16 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|