C20H20ClF3N2O3 — CID 90712211
ethyl 3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(cyclopropylmethoxy)pyrazol-5-yl]prop-2-enoate (PubChem CID 90712211) has the molecular formula C20H20ClF3N2O3 and a molecular weight of 428.84 g/mol. Its IUPAC name is ethyl 3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(cyclopropylmethoxy)pyrazol-5-yl]prop-2-enoate.
| Compound Name | ethyl 3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(cyclopropylmethoxy)pyrazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 90712211 |
| Molecular Formula | C20H20ClF3N2O3 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | ethyl 3-[1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(cyclopropylmethoxy)pyrazol-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(OCC2CC2)nn1Cc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H20ClF3N2O3/c1-2-28-19(27)8-7-16-10-18(29-12-13-3-4-13)25-26(16)11-14-5-6-15(9-17(14)21)20(22,23)24/h5-10,13H,2-4,11-12H2,1H3 |
| InChIKey | CWQLXVWBOSFPHB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|