C21H27Cl2N3O5S — CID 68549175
(E)-3-[1-[(2,4-dichlorophenyl)methyl]-3-(2-methoxyethoxy)pyrazol-5-yl]-N-(3-methylbutylsulfonyl)prop-2-enamide (PubChem CID 68549175) has the molecular formula C21H27Cl2N3O5S and a molecular weight of 504.44 g/mol. Its IUPAC name is (E)-3-[1-[(2,4-dichlorophenyl)methyl]-3-(2-methoxyethoxy)pyrazol-5-yl]-N-(3-methylbutylsulfonyl)prop-2-enamide.
| Compound Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-3-(2-methoxyethoxy)pyrazol-5-yl]-N-(3-methylbutylsulfonyl)prop-2-enamide |
|---|---|
| PubChem CID | 68549175 |
| Molecular Formula | C21H27Cl2N3O5S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-3-(2-methoxyethoxy)pyrazol-5-yl]-N-(3-methylbutylsulfonyl)prop-2-enamide |
| SMILES | COCCOc1cc(/C=C/C(=O)NS(=O)(=O)CCC(C)C)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C21H27Cl2N3O5S/c1-15(2)8-11-32(28,29)25-20(27)7-6-18-13-21(31-10-9-30-3)24-26(18)14-16-4-5-17(22)12-19(16)23/h4-7,12-13,15H,8-11,14H2,1-3H3,(H,25,27)/b7-6+ |
| InChIKey | JKDRNVFECTYMQF-VOTSOKGWSA-N |
| XLogP | 3.77 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|