C14H14Cl2N2O2 — CID 86617643
1-[(2,4-dichlorophenyl)methyl]-3-propan-2-yloxypyrazole-5-carbaldehyde (PubChem CID 86617643) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-propan-2-yloxypyrazole-5-carbaldehyde.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-propan-2-yloxypyrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 86617643 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-propan-2-yloxypyrazole-5-carbaldehyde |
| SMILES | CC(C)Oc1cc(C=O)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-9(2)20-14-6-12(8-19)18(17-14)7-10-3-4-11(15)5-13(10)16/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | GFKOAKCLUWBMGE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|