C20H28Cl2N2O — CID 173139860
3-butoxy-1-[(2,4-dichlorophenyl)methyl]-5-hexan-2-ylpyrazole (PubChem CID 173139860) has the molecular formula C20H28Cl2N2O and a molecular weight of 383.36 g/mol. Its IUPAC name is 3-butoxy-1-[(2,4-dichlorophenyl)methyl]-5-hexan-2-ylpyrazole.
| Compound Name | 3-butoxy-1-[(2,4-dichlorophenyl)methyl]-5-hexan-2-ylpyrazole |
|---|---|
| PubChem CID | 173139860 |
| Molecular Formula | C20H28Cl2N2O |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-butoxy-1-[(2,4-dichlorophenyl)methyl]-5-hexan-2-ylpyrazole |
| SMILES | CCCCOc1cc(C(C)CCCC)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H28Cl2N2O/c1-4-6-8-15(3)19-13-20(25-11-7-5-2)23-24(19)14-16-9-10-17(21)12-18(16)22/h9-10,12-13,15H,4-8,11,14H2,1-3H3 |
| InChIKey | LRJMBFMAZSRPES-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|