C16H9Cl2F3N4O2 — CID 68913179
3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)pyrazolo[3,4-b]pyrazin-3-yl]prop-2-enoic acid (PubChem CID 68913179) has the molecular formula C16H9Cl2F3N4O2 and a molecular weight of 417.17 g/mol. Its IUPAC name is 3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)pyrazolo[3,4-b]pyrazin-3-yl]prop-2-enoic acid.
| Compound Name | 3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)pyrazolo[3,4-b]pyrazin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68913179 |
| Molecular Formula | C16H9Cl2F3N4O2 |
| Molecular Weight | 417.17 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)pyrazolo[3,4-b]pyrazin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1nn(Cc2ccc(Cl)cc2Cl)c2nc(C(F)(F)F)cnc12 |
| InChI | InChI=1S/C16H9Cl2F3N4O2/c17-9-2-1-8(10(18)5-9)7-25-15-14(11(24-25)3-4-13(26)27)22-6-12(23-15)16(19,20)21/h1-6H,7H2,(H,26,27) |
| InChIKey | OGKMJWFZZKXAML-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.17 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|