C17H10Cl2F3N3O2 — CID 90904239
3-[4-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]prop-2-enoic acid (PubChem CID 90904239) has the molecular formula C17H10Cl2F3N3O2 and a molecular weight of 416.19 g/mol. Its IUPAC name is 3-[4-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | 3-[4-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90904239 |
| Molecular Formula | C17H10Cl2F3N3O2 |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 3-[4-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1[nH]nc2nc(C(F)(F)F)cc(Cc3ccc(Cl)cc3Cl)c12 |
| InChI | InChI=1S/C17H10Cl2F3N3O2/c18-10-2-1-8(11(19)7-10)5-9-6-13(17(20,21)22)23-16-15(9)12(24-25-16)3-4-14(26)27/h1-4,6-7H,5H2,(H,26,27)(H,23,24,25) |
| InChIKey | ZLTJGJUIGUUUFE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|