About 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid
2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid (PubChem CID 175271767) has the molecular formula C14H10Cl2F3N3O2
and a molecular weight of 380.15 g/mol. Its IUPAC name is 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid |
| PubChem CID | 175271767 |
| Molecular Formula | C14H10Cl2F3N3O2 |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid |
| SMILES | O=C(O)Cc1cnc(NCc2ccc(Cl)cc2Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C14H10Cl2F3N3O2/c15-9-2-1-7(10(16)4-9)5-20-13-21-6-8(3-11(23)24)12(22-13)14(17,18)19/h1-2,4,6H,3,5H2,(H,23,24)(H,20,21,22) |
| InChIKey | LHQQMVWEXSYCEL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid?
The IUPAC name of 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid (CID 175271767) is 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid.
What is the SMILES notation for 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid?
The canonical SMILES for 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid is O=C(O)Cc1cnc(NCc2ccc(Cl)cc2Cl)nc1C(F)(F)F.
What is the InChIKey of 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid?
The InChIKey is LHQQMVWEXSYCEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2F3N3O2/c15-9-2-1-7(10(16)4-9)5-20-13-21-6-8(3-11(23)24)12(22-13)14(17,18)19/h1-2,4,6H,3,5H2,(H,23,24)(H,20,21,22).
What are the key properties of 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid?
2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid has a molecular weight of 380.15 g/mol, XLogP of 4.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)pyrimidin-5-yl]acetic acid is sourced from PubChem (CID 175271767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).