C14H11Cl2NO2 — CID 39150558
(E)-3-[1-[(2,4-dichlorophenyl)methyl]pyrrol-2-yl]prop-2-enoic acid (PubChem CID 39150558) has the molecular formula C14H11Cl2NO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is (E)-3-[1-[(2,4-dichlorophenyl)methyl]pyrrol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]pyrrol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39150558 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]pyrrol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c15-11-4-3-10(13(16)8-11)9-17-7-1-2-12(17)5-6-14(18)19/h1-8H,9H2,(H,18,19)/b6-5+ |
| InChIKey | QVMNBFMVKYIMCM-AATRIKPKSA-N |
| XLogP | 3.94 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|