C18H11Cl2F2NO3 — CID 66917669
(E)-3-[1-[(2,4-dichlorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]prop-2-enoic acid (PubChem CID 66917669) has the molecular formula C18H11Cl2F2NO3 and a molecular weight of 398.19 g/mol. Its IUPAC name is (E)-3-[1-[(2,4-dichlorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66917669 |
| Molecular Formula | C18H11Cl2F2NO3 |
| Molecular Weight | 398.19 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc2c1N(Cc1ccc(Cl)cc1Cl)C(=O)C2(F)F |
| InChI | InChI=1S/C18H11Cl2F2NO3/c19-12-6-4-11(14(20)8-12)9-23-16-10(5-7-15(24)25)2-1-3-13(16)18(21,22)17(23)26/h1-8H,9H2,(H,24,25)/b7-5+ |
| InChIKey | MHMJUCJRZATTPG-FNORWQNLSA-N |
| XLogP | 4.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.19 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|