C24H13F7N2O4S — CID 46886027
(E)-3-[1-[(3,4-difluorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide (PubChem CID 46886027) has the molecular formula C24H13F7N2O4S and a molecular weight of 558.43 g/mol. Its IUPAC name is (E)-3-[1-[(3,4-difluorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[1-[(3,4-difluorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 46886027 |
| Molecular Formula | C24H13F7N2O4S |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | (E)-3-[1-[(3,4-difluorophenyl)methyl]-3,3-difluoro-2-oxoindol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c1N(Cc1ccc(F)c(F)c1)C(=O)C2(F)F)NS(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H13F7N2O4S/c25-15-6-4-12(8-16(15)26)11-33-22-13(2-1-3-14(22)24(30,31)23(33)35)5-7-21(34)32-38(36,37)20-10-18(28)17(27)9-19(20)29/h1-10H,11H2,(H,32,34)/b7-5+ |
| InChIKey | RMABTHGRUWJYLD-FNORWQNLSA-N |
| XLogP | 4.54 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|