C28H19F3N2O5S — CID 46885735
(E)-3-[3-hydroxy-1-(naphthalen-2-ylmethyl)-2-oxo-3H-indol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide (PubChem CID 46885735) has the molecular formula C28H19F3N2O5S and a molecular weight of 552.53 g/mol. Its IUPAC name is (E)-3-[3-hydroxy-1-(naphthalen-2-ylmethyl)-2-oxo-3H-indol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[3-hydroxy-1-(naphthalen-2-ylmethyl)-2-oxo-3H-indol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 46885735 |
| Molecular Formula | C28H19F3N2O5S |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | (E)-3-[3-hydroxy-1-(naphthalen-2-ylmethyl)-2-oxo-3H-indol-7-yl]-N-(2,4,5-trifluorophenyl)sulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c1N(Cc1ccc3ccccc3c1)C(=O)C2O)NS(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C28H19F3N2O5S/c29-21-13-23(31)24(14-22(21)30)39(37,38)32-25(34)11-10-18-6-3-7-20-26(18)33(28(36)27(20)35)15-16-8-9-17-4-1-2-5-19(17)12-16/h1-14,27,35H,15H2,(H,32,34)/b11-10+ |
| InChIKey | FBMLUXABXAEURE-ZHACJKMWSA-N |
| XLogP | 4.36 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|