C30H27F2N3O4S2 — CID 158817684
(E)-N-(3,4-difluorophenyl)sulfonyl-3-[3-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)thiophen-2-yl]prop-2-enamide;methane (PubChem CID 158817684) has the molecular formula C30H27F2N3O4S2 and a molecular weight of 595.69 g/mol. Its IUPAC name is (E)-N-(3,4-difluorophenyl)sulfonyl-3-[3-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)thiophen-2-yl]prop-2-enamide;methane.
| Compound Name | (E)-N-(3,4-difluorophenyl)sulfonyl-3-[3-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)thiophen-2-yl]prop-2-enamide;methane |
|---|---|
| PubChem CID | 158817684 |
| Molecular Formula | C30H27F2N3O4S2 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | (E)-N-(3,4-difluorophenyl)sulfonyl-3-[3-(2-naphthalen-2-ylethoxy)-4-(pyrazol-1-ylmethyl)thiophen-2-yl]prop-2-enamide;methane |
| SMILES | C.O=C(/C=C/c1scc(Cn2cccn2)c1OCCc1ccc2ccccc2c1)NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C29H23F2N3O4S2.CH4/c30-25-9-8-24(17-26(25)31)40(36,37)33-28(35)11-10-27-29(23(19-39-27)18-34-14-3-13-32-34)38-15-12-20-6-7-21-4-1-2-5-22(21)16-20;/h1-11,13-14,16-17,19H,12,15,18H2,(H,33,35);1H4/b11-10+; |
| InChIKey | IVLXFBIOMYIRCL-ASTDGNLGSA-N |
| XLogP | 6.20 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|