About CID 69460171
CID 69460171 (PubChem CID 69460171) has the molecular formula C35H28F2N2NaO5S
and a molecular weight of 649.67 g/mol.
Molecular Properties
| Compound Name | CID 69460171 |
| PubChem CID | 69460171 |
| Molecular Formula | C35H28F2N2NaO5S |
| Molecular Weight | 649.67 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | — |
| SMILES | N#Cc1cccc(OCc2ccc(CCC(=O)NS(=O)(=O)c3ccc(F)c(F)c3)c(OCCc3ccc4ccccc4c3)c2)c1.[Na] |
| InChI | InChI=1S/C35H28F2N2O5S.Na/c36-32-14-13-31(21-33(32)37)45(41,42)39-35(40)15-12-28-11-9-26(23-44-30-7-3-4-25(19-30)22-38)20-34(28)43-17-16-24-8-10-27-5-1-2-6-29(27)18-24;/h1-11,13-14,18-21H,12,15-17,23H2,(H,39,40); |
| InChIKey | GLDRFOGFXDQGNS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 649.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 69460171 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69460171?
The IUPAC name of CID 69460171 (CID 69460171) is not available.
What is the SMILES notation for CID 69460171?
The canonical SMILES for CID 69460171 is N#Cc1cccc(OCc2ccc(CCC(=O)NS(=O)(=O)c3ccc(F)c(F)c3)c(OCCc3ccc4ccccc4c3)c2)c1.[Na].
What is the InChIKey of CID 69460171?
The InChIKey is GLDRFOGFXDQGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H28F2N2O5S.Na/c36-32-14-13-31(21-33(32)37)45(41,42)39-35(40)15-12-28-11-9-26(23-44-30-7-3-4-25(19-30)22-38)20-34(28)43-17-16-24-8-10-27-5-1-2-6-29(27)18-24;/h1-11,13-14,18-21H,12,15-17,23H2,(H,39,40);.
What are the key properties of CID 69460171?
CID 69460171 has a molecular weight of 649.67 g/mol, XLogP of 6.25, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69460171 is sourced from PubChem (CID 69460171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).