C23H20N2O3S — CID 10135862
(E)-3-[4-(2-naphthalen-2-ylethoxy)-5-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 10135862) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is (E)-3-[4-(2-naphthalen-2-ylethoxy)-5-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-naphthalen-2-ylethoxy)-5-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10135862 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (E)-3-[4-(2-naphthalen-2-ylethoxy)-5-(pyrazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1csc(Cn2cccn2)c1OCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H20N2O3S/c26-22(27)9-8-20-16-29-21(15-25-12-3-11-24-25)23(20)28-13-10-17-6-7-18-4-1-2-5-19(18)14-17/h1-9,11-12,14,16H,10,13,15H2,(H,26,27)/b9-8+ |
| InChIKey | KCEIPWMLSPDTOL-CMDGGOBGSA-N |
| XLogP | 4.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|